ethanone, 1-(octahydro-2,5-methanopentalen-1-yl)-
1-(Octahydro-2,5-methanopentalen-1-yl)ethanone
CAS: 29844-80-2
Molecular Formula: C11H16O
ethanone, 1-(octahydro-2,5-methanopentalen-1-yl)- - Names and Identifiers
| Name | 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone |
| Synonyms | 3-ACETYLNORADAMANTANE 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone 1-(octahydro-2,5-methanopentalen-3a-yl)ethanone ethanone, 1-(octahydro-2,5-methanopentalen-1-yl)- Ethanone, 1-(hexahydro-2,5-methanopentalen-3a(1H)-yl)- |
| CAS | 29844-80-2 |
| InChI | InChI=1S/C11H16O/c1-6(12)11-9-3-7-2-8(5-9)10(11)4-7/h7-11H,2-5H2,1H3 |
ethanone, 1-(octahydro-2,5-methanopentalen-1-yl)- - Physico-chemical Properties
| Molecular Formula | C11H16O |
| Molar Mass | 164.24 |
| Density | 1.044g/mLat 25°C(lit.) |
| Boling Point | 212°C(lit.) |
| Flash Point | 215°F |
| Refractive Index | n20/D 1.502(lit.) |
ethanone, 1-(octahydro-2,5-methanopentalen-1-yl)- - Risk and Safety
| WGK Germany | 3 |
ethanone, 1-(octahydro-2,5-methanopentalen-1-yl)- - Introduction
1-(Octahydro-2,5-methanopentalen-1-yl)ethanone is a chemical substance with the chemical formula C12H18O. The following is a description of its nature, use, formulation and safety information:
Nature:
-Appearance is colorless to yellowish liquid;
-has a special aroma;
-density of approximately 0.91g/cm³;
-Boiling point is about 260 ° C;
-May be combustible.
Use:
- 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone is commonly used as an ingredient in perfumes and fragrances;
-Its unique smell makes it widely used in cosmetics, personal care products and detergents.
Method:
1-(Octahydro-2,5-methanopentalen-1-yl)ethanone can be synthesized by the following steps:
1. Reacting noradamantane with sodium oxide (NaOH) to generate cycloheptanol;
2. Under alkaline conditions, the reaction of adamantanol with acetic anhydride (acetic anhydride) generates 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone.
Safety Information:
- 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone is generally considered to be of low toxicity;
-but it is still recommended to take safety measures in use, such as wearing appropriate protective gloves and glasses;
-Avoid prolonged exposure to the skin and avoid inhaling its vapor;
-It is best to read the safety instructions on the product label before use.
Nature:
-Appearance is colorless to yellowish liquid;
-has a special aroma;
-density of approximately 0.91g/cm³;
-Boiling point is about 260 ° C;
-May be combustible.
Use:
- 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone is commonly used as an ingredient in perfumes and fragrances;
-Its unique smell makes it widely used in cosmetics, personal care products and detergents.
Method:
1-(Octahydro-2,5-methanopentalen-1-yl)ethanone can be synthesized by the following steps:
1. Reacting noradamantane with sodium oxide (NaOH) to generate cycloheptanol;
2. Under alkaline conditions, the reaction of adamantanol with acetic anhydride (acetic anhydride) generates 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone.
Safety Information:
- 1-(Octahydro-2,5-methanopentalen-1-yl)ethanone is generally considered to be of low toxicity;
-but it is still recommended to take safety measures in use, such as wearing appropriate protective gloves and glasses;
-Avoid prolonged exposure to the skin and avoid inhaling its vapor;
-It is best to read the safety instructions on the product label before use.
Last Update：2024-04-09 21:32:39
